C15H21F3IN3O2S — CID 111048215
N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111048215) has the molecular formula C15H21F3IN3O2S and a molecular weight of 491.32 g/mol. Its IUPAC name is N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111048215 |
| Molecular Formula | C15H21F3IN3O2S |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | COc1cc(C/N=C(\N)N2CCSCC2)ccc1OCC(F)(F)F.I |
| InChI | InChI=1S/C15H20F3N3O2S.HI/c1-22-13-8-11(2-3-12(13)23-10-15(16,17)18)9-20-14(19)21-4-6-24-7-5-21;/h2-3,8H,4-7,9-10H2,1H3,(H2,19,20);1H |
| InChIKey | UGFMIXOVYGQYHS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|