C20H21F3N4O3 — CID 111083065
N-[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111083065) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is N-[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111083065 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | N/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N4O3/c21-20(22,23)30-16-8-6-14(7-9-16)27-19(24)25-12-13-3-1-4-15(11-13)26-18(28)17-5-2-10-29-17/h1,3-4,6-9,11,17H,2,5,10,12H2,(H,26,28)(H3,24,25,27) |
| InChIKey | PQUYNJSZZAOSQM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|