C17H26N4O2 — CID 111083043
N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111083043) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111083043 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | CC(C)(C)N/C(N)=N/Cc1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C17H26N4O2/c1-17(2,3)21-16(18)19-11-12-6-4-7-13(10-12)20-15(22)14-8-5-9-23-14/h4,6-7,10,14H,5,8-9,11H2,1-3H3,(H,20,22)(H3,18,19,21) |
| InChIKey | JPZZQZDOPUDVHF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|