C25H40IN5O — CID 111762984
1-[[3-[[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111762984) has the molecular formula C25H40IN5O and a molecular weight of 553.53 g/mol. Its IUPAC name is 1-[[3-[[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[[3-[[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111762984 |
| Molecular Formula | C25H40IN5O |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 1-[[3-[[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCCC(C(N)=O)C2)c1)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C25H39N5O.HI/c1-2-27-25(28-14-13-20-8-4-3-5-9-20)29-17-21-10-6-11-22(16-21)18-30-15-7-12-23(19-30)24(26)31;/h6,8,10-11,16,23H,2-5,7,9,12-15,17-19H2,1H3,(H2,26,31)(H2,27,28,29);1H |
| InChIKey | SHTPMPDFMDPVJW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|