C17H29IN6 — CID 111040089
1-(cyclobutylmethyl)-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111040089) has the molecular formula C17H29IN6 and a molecular weight of 444.37 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111040089 |
| Molecular Formula | C17H29IN6 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CN1CCN(c2ccc(C/N=C(\N)NCC3CCC3)cn2)CC1.I |
| InChI | InChI=1S/C17H28N6.HI/c1-22-7-9-23(10-8-22)16-6-5-15(12-19-16)13-21-17(18)20-11-14-3-2-4-14;/h5-6,12,14H,2-4,7-11,13H2,1H3,(H3,18,20,21);1H |
| InChIKey | NSVQUAJZRNTZNR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|