C24H27IN4O — CID 111721412
2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111721412) has the molecular formula C24H27IN4O and a molecular weight of 514.41 g/mol. Its IUPAC name is 2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111721412 |
| Molecular Formula | C24H27IN4O |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 2-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(Cn2ccccc2=O)cc1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C24H26N4O.HI/c25-24(27-22-9-5-7-20-6-1-2-8-21(20)22)26-16-18-11-13-19(14-12-18)17-28-15-4-3-10-23(28)29;/h3-5,7,9-15H,1-2,6,8,16-17H2,(H3,25,26,27);1H |
| InChIKey | FKOODZUPZKYJGO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|