C24H32N4O — CID 122099319
2-[(1-benzyl-4-hydroxypiperidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 122099319) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[(1-benzyl-4-hydroxypiperidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[(1-benzyl-4-hydroxypiperidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 122099319 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 2-[(1-benzyl-4-hydroxypiperidin-4-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | N/C(=N\CC1(O)CCN(Cc2ccccc2)CC1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C24H32N4O/c25-23(27-22-12-6-10-20-9-4-5-11-21(20)22)26-18-24(29)13-15-28(16-14-24)17-19-7-2-1-3-8-19/h1-3,6-8,10,12,29H,4-5,9,11,13-18H2,(H3,25,26,27) |
| InChIKey | JPTCMWGUMKKGSX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|