C23H36N4O — CID 119147176
2-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 119147176) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 119147176 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 2-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | COC1CCN(C2(C/N=C(\N)Nc3cccc4c3CCCC4)CCCC2)CC1 |
| InChI | InChI=1S/C23H36N4O/c1-28-19-11-15-27(16-12-19)23(13-4-5-14-23)17-25-22(24)26-21-10-6-8-18-7-2-3-9-20(18)21/h6,8,10,19H,2-5,7,9,11-17H2,1H3,(H3,24,25,26) |
| InChIKey | AOGHGZYYQMLANK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|