C16H22IN3O2S — CID 111046046
2-[(3,4-dimethoxyphenyl)methyl]-1-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111046046) has the molecular formula C16H22IN3O2S and a molecular weight of 447.34 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111046046 |
| Molecular Formula | C16H22IN3O2S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCc2ccc(C)s2)cc1OC.I |
| InChI | InChI=1S/C16H21N3O2S.HI/c1-11-4-6-13(22-11)10-19-16(17)18-9-12-5-7-14(20-2)15(8-12)21-3;/h4-8H,9-10H2,1-3H3,(H3,17,18,19);1H |
| InChIKey | IBWQVEVVOTXMCM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|