C18H20F3N7S — CID 111689164
1-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689164) has the molecular formula C18H20F3N7S and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689164 |
| Molecular Formula | C18H20F3N7S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C18H20F3N7S/c1-2-23-17(24-8-7-16-27-15(10-29-16)18(19,20)21)25-9-13-3-5-14(6-4-13)28-12-22-11-26-28/h3-6,10-12H,2,7-9H2,1H3,(H2,23,24,25) |
| InChIKey | CDYVQFLKEZDMNE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|