C18H21F3IN7S — CID 111689905
1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689905) has the molecular formula C18H21F3IN7S and a molecular weight of 551.38 g/mol. Its IUPAC name is 1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689905 |
| Molecular Formula | C18H21F3IN7S |
| Molecular Weight | 551.38 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)nc1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C18H20F3N7S.HI/c1-2-23-17(24-6-5-16-27-14(11-29-16)18(19,20)21)26-10-13-3-4-15(25-9-13)28-8-7-22-12-28;/h3-4,7-9,11-12H,2,5-6,10H2,1H3,(H2,23,24,26);1H |
| InChIKey | NEKHOOCJJMZTLR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|