C19H25IN6S — CID 111957264
1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111957264) has the molecular formula C19H25IN6S and a molecular weight of 496.42 g/mol. Its IUPAC name is 1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111957264 |
| Molecular Formula | C19H25IN6S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)nc1)NCc1ccc(CC)s1.I |
| InChI | InChI=1S/C19H24N6S.HI/c1-3-16-6-7-17(26-16)13-24-19(21-4-2)23-12-15-5-8-18(22-11-15)25-10-9-20-14-25;/h5-11,14H,3-4,12-13H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | DHJAIXTUCMMXLP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|