C17H25IN6O — CID 111139556
1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111139556) has the molecular formula C17H25IN6O and a molecular weight of 456.33 g/mol. Its IUPAC name is 1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111139556 |
| Molecular Formula | C17H25IN6O |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-ethyl-2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)nc1)NCC1CCCO1.I |
| InChI | InChI=1S/C17H24N6O.HI/c1-2-19-17(22-12-15-4-3-9-24-15)21-11-14-5-6-16(20-10-14)23-8-7-18-13-23;/h5-8,10,13,15H,2-4,9,11-12H2,1H3,(H2,19,21,22);1H |
| InChIKey | CTWQIXJAGOIPCO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|