C20H35FIN5O — CID 110998660
2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 110998660) has the molecular formula C20H35FIN5O and a molecular weight of 507.44 g/mol. Its IUPAC name is 2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110998660 |
| Molecular Formula | C20H35FIN5O |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(F)c1)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C20H34FN5O.HI/c1-5-22-20(24-16(4)10-9-13-26(6-2)7-3)23-15-19(27)25-18-12-8-11-17(21)14-18;/h8,11-12,14,16H,5-7,9-10,13,15H2,1-4H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | FSVLNMTXBGRKTH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|