C19H33FIN5O — CID 110998658
2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 110998658) has the molecular formula C19H33FIN5O and a molecular weight of 493.41 g/mol. Its IUPAC name is 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110998658 |
| Molecular Formula | C19H33FIN5O |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-methylcarbamimidoyl]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCC(=O)Nc1cccc(F)c1.I |
| InChI | InChI=1S/C19H32FN5O.HI/c1-5-25(6-2)12-8-9-15(3)23-19(21-4)22-14-18(26)24-17-11-7-10-16(20)13-17;/h7,10-11,13,15H,5-6,8-9,12,14H2,1-4H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | JWUAGPGCRLLPBG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|