C23H39FN4O — CID 110997915
1-[5-(diethylamino)pentan-2-yl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine (PubChem CID 110997915) has the molecular formula C23H39FN4O and a molecular weight of 406.59 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110997915 |
| Molecular Formula | C23H39FN4O |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C23H39FN4O/c1-5-28(6-2)14-8-9-19(3)27-22(25-4)26-18-23(12-15-29-16-13-23)20-10-7-11-21(24)17-20/h7,10-11,17,19H,5-6,8-9,12-16,18H2,1-4H3,(H2,25,26,27) |
| InChIKey | JLZBIXYOYMBGRD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|