C20H32FN3O — CID 111890909
1-(2-ethylbutyl)-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine (PubChem CID 111890909) has the molecular formula C20H32FN3O and a molecular weight of 349.49 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-(2-ethylbutyl)-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111890909 |
| Molecular Formula | C20H32FN3O |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-(2-ethylbutyl)-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
| SMILES | CCC(CC)CN/C(=N\C)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C20H32FN3O/c1-4-16(5-2)14-23-19(22-3)24-15-20(9-11-25-12-10-20)17-7-6-8-18(21)13-17/h6-8,13,16H,4-5,9-12,14-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | KJBZRQHUBGTEJR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|