C22H27ClFN3O — CID 111358138
1-[2-(3-chlorophenyl)ethyl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine (PubChem CID 111358138) has the molecular formula C22H27ClFN3O and a molecular weight of 403.93 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111358138 |
| Molecular Formula | C22H27ClFN3O |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C22H27ClFN3O/c1-25-21(26-11-8-17-4-2-6-19(23)14-17)27-16-22(9-12-28-13-10-22)18-5-3-7-20(24)15-18/h2-7,14-15H,8-13,16H2,1H3,(H2,25,26,27) |
| InChIKey | RGZMXTDQQSVWKH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|