C21H26FN3O — CID 111638310
1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine (PubChem CID 111638310) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111638310 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1cccc(OC)c1)NCC1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H26FN3O/c1-23-20(24-12-9-16-5-3-8-19(13-16)26-2)25-15-21(10-11-21)17-6-4-7-18(22)14-17/h3-8,13-14H,9-12,15H2,1-2H3,(H2,23,24,25) |
| InChIKey | UVBVXDJBBLXAQS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|