C22H26F4IN3O2 — CID 111847516
1-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111847516) has the molecular formula C22H26F4IN3O2 and a molecular weight of 567.37 g/mol. Its IUPAC name is 1-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111847516 |
| Molecular Formula | C22H26F4IN3O2 |
| Molecular Weight | 567.37 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | 1-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OC(F)(F)F)NCC1(c2cccc(F)c2)CCOCC1.I |
| InChI | InChI=1S/C22H25F4N3O2.HI/c1-27-20(28-14-16-5-2-3-8-19(16)31-22(24,25)26)29-15-21(9-11-30-12-10-21)17-6-4-7-18(23)13-17;/h2-8,13H,9-12,14-15H2,1H3,(H2,27,28,29);1H |
| InChIKey | VRAROALXOSKSEM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|