C22H38N4O — CID 110999139
1-[5-(diethylamino)pentan-2-yl]-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-2-methylguanidine (PubChem CID 110999139) has the molecular formula C22H38N4O and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-2-methylguanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110999139 |
| Molecular Formula | C22H38N4O |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-2-methylguanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCC1(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H38N4O/c1-6-26(7-2)16-10-11-18(3)25-21(23-4)24-17-22(14-15-22)19-12-8-9-13-20(19)27-5/h8-9,12-13,18H,6-7,10-11,14-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | UJDCAGYMXQLUDT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|