C16H21FN6O — CID 111954643
2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 111954643) has the molecular formula C16H21FN6O and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111954643 |
| Molecular Formula | C16H21FN6O |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN6O/c1-3-18-16(19-10-14-7-8-21-23(14)2)20-11-15(24)22-13-6-4-5-12(17)9-13/h4-9H,3,10-11H2,1-2H3,(H,22,24)(H2,18,19,20) |
| InChIKey | QTIYUCFZNNAFBU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|