C17H22IN7O — CID 111705186
2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 111705186) has the molecular formula C17H22IN7O and a molecular weight of 467.32 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111705186 |
| Molecular Formula | C17H22IN7O |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N/Cc2ncnn2C)NCC)c1.I |
| InChI | InChI=1S/C17H21N7O.HI/c1-4-13-7-6-8-14(9-13)23-16(25)11-20-17(18-5-2)19-10-15-21-12-22-24(15)3;/h1,6-9,12H,5,10-11H2,2-3H3,(H,23,25)(H2,18,19,20);1H |
| InChIKey | YEDVVRBFOMXRSP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|