C23H26ClN5O2 — CID 111552268
N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111552268) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111552268 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCCC(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C23H26ClN5O2/c1-3-25-23(26-12-11-21(30)29-20-10-9-16(2)13-19(20)24)27-14-18-15-31-22(28-18)17-7-5-4-6-8-17/h4-10,13,15H,3,11-12,14H2,1-2H3,(H,29,30)(H2,25,26,27) |
| InChIKey | XWVWIGBOUWZGII-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|