C19H25ClN4OS — CID 111898929
N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111898929) has the molecular formula C19H25ClN4OS and a molecular weight of 392.96 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111898929 |
| Molecular Formula | C19H25ClN4OS |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCC(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C19H25ClN4OS/c1-4-21-19(23-12-15-7-6-14(3)26-15)22-10-9-18(25)24-17-8-5-13(2)11-16(17)20/h5-8,11H,4,9-10,12H2,1-3H3,(H,24,25)(H2,21,22,23) |
| InChIKey | FLHHXYICEMGUJO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|