C20H23ClF2N4O — CID 111903031
N-(2-chloro-4-methylphenyl)-3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide (PubChem CID 111903031) has the molecular formula C20H23ClF2N4O and a molecular weight of 408.88 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111903031 |
| Molecular Formula | C20H23ClF2N4O |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCC(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C20H23ClF2N4O/c1-3-24-20(26-12-14-11-15(22)5-6-17(14)23)25-9-8-19(28)27-18-7-4-13(2)10-16(18)21/h4-7,10-11H,3,8-9,12H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | QZQIRVAREHKFFZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|