C20H25ClFIN4O — CID 111395792
N-(2-chloro-4-methylphenyl)-3-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111395792) has the molecular formula C20H25ClFIN4O and a molecular weight of 518.80 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111395792 |
| Molecular Formula | C20H25ClFIN4O |
| Molecular Weight | 518.80 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)Nc1ccc(C)cc1Cl)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C20H24ClFN4O.HI/c1-14-6-7-18(17(21)12-14)26-19(27)9-11-25-20(23-2)24-10-8-15-4-3-5-16(22)13-15;/h3-7,12-13H,8-11H2,1-2H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | HVPKXIUWJPWJBF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|