C17H27ClN4O — CID 111002393
N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]propanamide (PubChem CID 111002393) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111002393 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(3-methylbutan-2-yl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1ccc(C)cc1Cl)NC(C)C(C)C |
| InChI | InChI=1S/C17H27ClN4O/c1-11(2)13(4)21-17(19-5)20-9-8-16(23)22-15-7-6-12(3)10-14(15)18/h6-7,10-11,13H,8-9H2,1-5H3,(H,22,23)(H2,19,20,21) |
| InChIKey | RSLJPHAGQXWMQF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|