C17H27ClN4O — CID 111159635
3-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2-chloro-4-methylphenyl)propanamide (PubChem CID 111159635) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is 3-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2-chloro-4-methylphenyl)propanamide.
| Compound Name | 3-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2-chloro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 111159635 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]-N-(2-chloro-4-methylphenyl)propanamide |
| SMILES | CCCCN(C)/C(=N\C)NCCC(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C17H27ClN4O/c1-5-6-11-22(4)17(19-3)20-10-9-16(23)21-15-8-7-13(2)12-14(15)18/h7-8,12H,5-6,9-11H2,1-4H3,(H,19,20)(H,21,23) |
| InChIKey | JHVFVNDEPPOWQZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|