C15H24ClN3 — CID 111160008
1-butyl-3-[2-(2-chlorophenyl)ethyl]-1,2-dimethylguanidine (PubChem CID 111160008) has the molecular formula C15H24ClN3 and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-butyl-3-[2-(2-chlorophenyl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-butyl-3-[2-(2-chlorophenyl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111160008 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-butyl-3-[2-(2-chlorophenyl)ethyl]-1,2-dimethylguanidine |
| SMILES | CCCCN(C)/C(=N\C)NCCc1ccccc1Cl |
| InChI | InChI=1S/C15H24ClN3/c1-4-5-12-19(3)15(17-2)18-11-10-13-8-6-7-9-14(13)16/h6-9H,4-5,10-12H2,1-3H3,(H,17,18) |
| InChIKey | HHLTXSRXVWLPQZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|