C16H25F3IN3 — CID 111160009
1-butyl-1,2-dimethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111160009) has the molecular formula C16H25F3IN3 and a molecular weight of 443.30 g/mol. Its IUPAC name is 1-butyl-1,2-dimethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-1,2-dimethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111160009 |
| Molecular Formula | C16H25F3IN3 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 1-butyl-1,2-dimethyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NCCc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C16H24F3N3.HI/c1-4-5-12-22(3)15(20-2)21-11-10-13-6-8-14(9-7-13)16(17,18)19;/h6-9H,4-5,10-12H2,1-3H3,(H,20,21);1H |
| InChIKey | CZHPCRWNCMUOAL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|