C16H27N3O — CID 111158025
1-butyl-3-[(2-ethoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111158025) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-butyl-3-[(2-ethoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-butyl-3-[(2-ethoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111158025 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 1-butyl-3-[(2-ethoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | CCCCN(C)/C(=N\C)NCc1ccccc1OCC |
| InChI | InChI=1S/C16H27N3O/c1-5-7-12-19(4)16(17-3)18-13-14-10-8-9-11-15(14)20-6-2/h8-11H,5-7,12-13H2,1-4H3,(H,17,18) |
| InChIKey | BAONGIKJVOQKPK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|