C22H29ClIN5O2 — CID 111185637
N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide (PubChem CID 111185637) has the molecular formula C22H29ClIN5O2 and a molecular weight of 557.86 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111185637 |
| Molecular Formula | C22H29ClIN5O2 |
| Molecular Weight | 557.86 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-hydroxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)Nc1ccc(C)cc1Cl)N1CCN(c2ccccc2O)CC1.I |
| InChI | InChI=1S/C22H28ClN5O2.HI/c1-16-7-8-18(17(23)15-16)26-21(30)9-10-25-22(24-2)28-13-11-27(12-14-28)19-5-3-4-6-20(19)29;/h3-8,15,29H,9-14H2,1-2H3,(H,24,25)(H,26,30);1H |
| InChIKey | VGTCWVPZNXEFPW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|