C23H30ClN5O2 — CID 111133481
N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide (PubChem CID 111133481) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111133481 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)Nc1ccc(C)cc1Cl)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H30ClN5O2/c1-17-8-9-19(18(24)16-17)27-22(30)10-11-26-23(25-2)29-14-12-28(13-15-29)20-6-4-5-7-21(20)31-3/h4-9,16H,10-15H2,1-3H3,(H,25,26)(H,27,30) |
| InChIKey | MHHSFGZONHTCLL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|