C19H25ClIN5O — CID 111191977
N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111191977) has the molecular formula C19H25ClIN5O and a molecular weight of 501.80 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111191977 |
| Molecular Formula | C19H25ClIN5O |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)Nc1ccc(C)cc1Cl)NCCc1ccccn1.I |
| InChI | InChI=1S/C19H24ClN5O.HI/c1-14-6-7-17(16(20)13-14)25-18(26)9-12-24-19(21-2)23-11-8-15-5-3-4-10-22-15;/h3-7,10,13H,8-9,11-12H2,1-2H3,(H,25,26)(H2,21,23,24);1H |
| InChIKey | HOHISTUFDGQYHC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|