C18H22ClF3IN5OS — CID 111689239
N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111689239) has the molecular formula C18H22ClF3IN5OS and a molecular weight of 575.83 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111689239 |
| Molecular Formula | C18H22ClF3IN5OS |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.02 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)Nc1ccc(C)cc1Cl)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C18H21ClF3N5OS.HI/c1-11-3-4-13(12(19)9-11)26-15(28)5-7-24-17(23-2)25-8-6-16-27-14(10-29-16)18(20,21)22;/h3-4,9-10H,5-8H2,1-2H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | BEYMAOYLDYDYAF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|