C22H32IN5O2 — CID 111553978
N-cyclohexyl-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111553978) has the molecular formula C22H32IN5O2 and a molecular weight of 525.44 g/mol. Its IUPAC name is N-cyclohexyl-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-cyclohexyl-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111553978 |
| Molecular Formula | C22H32IN5O2 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-cyclohexyl-3-[[N-ethyl-N'-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCCC(=O)NC1CCCCC1.I |
| InChI | InChI=1S/C22H31N5O2.HI/c1-2-23-22(24-14-13-20(28)26-18-11-7-4-8-12-18)25-15-19-16-29-21(27-19)17-9-5-3-6-10-17;/h3,5-6,9-10,16,18H,2,4,7-8,11-15H2,1H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | QGSVOZYLFKMQQY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|