C22H30FIN4O3S — CID 109446596
2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide (PubChem CID 109446596) has the molecular formula C22H30FIN4O3S and a molecular weight of 576.48 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109446596 |
| Molecular Formula | C22H30FIN4O3S |
| Molecular Weight | 576.48 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | 2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCC(=O)Nc1cccc(CC)c1.I |
| InChI | InChI=1S/C22H29FN4O3S.HI/c1-4-16-7-6-8-20(11-16)27-21(28)14-26-22(24-5-2)25-13-18-12-19(23)10-9-17(18)15-31(3,29)30;/h6-12H,4-5,13-15H2,1-3H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | YNXGGWHLTZIXQX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|