C18H32FIN4O2S — CID 109444594
1-[2-(tert-butylamino)ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109444594) has the molecular formula C18H32FIN4O2S and a molecular weight of 514.45 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(tert-butylamino)ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109444594 |
| Molecular Formula | C18H32FIN4O2S |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 1-[2-(tert-butylamino)ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCCNC(C)(C)C.I |
| InChI | InChI=1S/C18H31FN4O2S.HI/c1-6-20-17(21-9-10-23-18(2,3)4)22-12-15-11-16(19)8-7-14(15)13-26(5,24)25;/h7-8,11,23H,6,9-10,12-13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | IKGYYAJAOWDBLV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|