C21H33FN4O3S — CID 109444655
2-cyclopentyl-N-[2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide (PubChem CID 109444655) has the molecular formula C21H33FN4O3S and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 109444655 |
| Molecular Formula | C21H33FN4O3S |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]acetamide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCCNC(=O)CC1CCCC1 |
| InChI | InChI=1S/C21H33FN4O3S/c1-3-23-21(25-11-10-24-20(27)12-16-6-4-5-7-16)26-14-18-13-19(22)9-8-17(18)15-30(2,28)29/h8-9,13,16H,3-7,10-12,14-15H2,1-2H3,(H,24,27)(H2,23,25,26) |
| InChIKey | YMTNTXAGUHKJMJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|