C20H31FIN3O2S — CID 109446290
1-[(1-cyclopropylcyclobutyl)methyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109446290) has the molecular formula C20H31FIN3O2S and a molecular weight of 523.46 g/mol. Its IUPAC name is 1-[(1-cyclopropylcyclobutyl)methyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-cyclopropylcyclobutyl)methyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109446290 |
| Molecular Formula | C20H31FIN3O2S |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 1-[(1-cyclopropylcyclobutyl)methyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCC1(C2CC2)CCC1.I |
| InChI | InChI=1S/C20H30FN3O2S.HI/c1-3-22-19(24-14-20(9-4-10-20)17-6-7-17)23-12-16-11-18(21)8-5-15(16)13-27(2,25)26;/h5,8,11,17H,3-4,6-7,9-10,12-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | ABIAMXPWXLTIIE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|