C18H29FIN3O2S — CID 109444884
1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(2-propylcyclopropyl)guanidine;hydroiodide (PubChem CID 109444884) has the molecular formula C18H29FIN3O2S and a molecular weight of 497.42 g/mol. Its IUPAC name is 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(2-propylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(2-propylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109444884 |
| Molecular Formula | C18H29FIN3O2S |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(2-propylcyclopropyl)guanidine;hydroiodide |
| SMILES | CCCC1CC1N/C(=N/Cc1cc(F)ccc1CS(C)(=O)=O)NCC.I |
| InChI | InChI=1S/C18H28FN3O2S.HI/c1-4-6-13-10-17(13)22-18(20-5-2)21-11-15-9-16(19)8-7-14(15)12-25(3,23)24;/h7-9,13,17H,4-6,10-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | CYVHFHCRKLQPEI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|