C19H31FIN5O2S — CID 109445476
1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109445476) has the molecular formula C19H31FIN5O2S and a molecular weight of 539.46 g/mol. Its IUPAC name is 1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109445476 |
| Molecular Formula | C19H31FIN5O2S |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCC1CN2CCN1CC2.I |
| InChI | InChI=1S/C19H30FN5O2S.HI/c1-3-21-19(23-12-18-13-24-6-8-25(18)9-7-24)22-11-16-10-17(20)5-4-15(16)14-28(2,26)27;/h4-5,10,18H,3,6-9,11-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | UWESZXGEXRVOKH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|