C18H30FIN4O3S — CID 109446038
3-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,2,2-trimethylpropanamide;hydroiodide (PubChem CID 109446038) has the molecular formula C18H30FIN4O3S and a molecular weight of 528.43 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,2,2-trimethylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,2,2-trimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109446038 |
| Molecular Formula | C18H30FIN4O3S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 3-[[N-ethyl-N'-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,2,2-trimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCC(C)(C)C(=O)NC.I |
| InChI | InChI=1S/C18H29FN4O3S.HI/c1-6-21-17(23-12-18(2,3)16(24)20-4)22-10-14-9-15(19)8-7-13(14)11-27(5,25)26;/h7-9H,6,10-12H2,1-5H3,(H,20,24)(H2,21,22,23);1H |
| InChIKey | ACUHHPMDBGPGBP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|