C19H34FIN4O2S — CID 109445262
1-[2-[butan-2-yl(methyl)amino]ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109445262) has the molecular formula C19H34FIN4O2S and a molecular weight of 528.48 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(methyl)amino]ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109445262 |
| Molecular Formula | C19H34FIN4O2S |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-3-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCCN(C)C(C)CC.I |
| InChI | InChI=1S/C19H33FN4O2S.HI/c1-6-15(3)24(4)11-10-22-19(21-7-2)23-13-17-12-18(20)9-8-16(17)14-27(5,25)26;/h8-9,12,15H,6-7,10-11,13-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | CMYMQJJFWNIZHJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|