C24H35IN8 — CID 111013902
1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111013902) has the molecular formula C24H35IN8 and a molecular weight of 562.50 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013902 |
| Molecular Formula | C24H35IN8 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCN(C)CC2)cc1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C24H34N8.HI/c1-3-25-24(27-18-23-29-28-22-7-4-5-14-32(22)23)26-17-20-8-10-21(11-9-20)19-31-13-6-12-30(2)15-16-31;/h4-5,7-11,14H,3,6,12-13,15-19H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | LYJWFILYXAKJJT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|