C23H31IN6O2 — CID 111564438
2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111564438) has the molecular formula C23H31IN6O2 and a molecular weight of 550.45 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111564438 |
| Molecular Formula | C23H31IN6O2 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC1CCCC1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C23H30N6O2.HI/c1-3-24-23(26-16-21-28-27-20-13-6-7-14-29(20)21)25-15-17-9-8-12-19(30-2)22(17)31-18-10-4-5-11-18;/h6-9,12-14,18H,3-5,10-11,15-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XHCOXBWJCBFJDS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|