C18H24IN7O2S — CID 111014330
1-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014330) has the molecular formula C18H24IN7O2S and a molecular weight of 529.41 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014330 |
| Molecular Formula | C18H24IN7O2S |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 1-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1NS(C)(=O)=O)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H23N7O2S.HI/c1-3-19-18(21-13-17-23-22-16-10-6-7-11-25(16)17)20-12-14-8-4-5-9-15(14)24-28(2,26)27;/h4-11,24H,3,12-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | IISGPSQJYQAOFT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|