C22H35IN4O2S — CID 111836914
1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111836914) has the molecular formula C22H35IN4O2S and a molecular weight of 546.52 g/mol. Its IUPAC name is 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111836914 |
| Molecular Formula | C22H35IN4O2S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N/C)NCc2nc(C(C)(C)C)cs2)cc1OCC.I |
| InChI | InChI=1S/C22H34N4O2S.HI/c1-7-27-17-10-9-16(13-18(17)28-8-2)11-12-24-21(23-6)25-14-20-26-19(15-29-20)22(3,4)5;/h9-10,13,15H,7-8,11-12,14H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | NTGVUMCNQYMKRR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|