C18H29N5S — CID 111514114
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 111514114) has the molecular formula C18H29N5S and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111514114 |
| Molecular Formula | C18H29N5S |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | C/N=C(/NCCCn1nc(C)cc1C)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C18H29N5S/c1-14(11-17-7-5-10-24-17)13-21-18(19-4)20-8-6-9-23-16(3)12-15(2)22-23/h5,7,10,12,14H,6,8-9,11,13H2,1-4H3,(H2,19,20,21) |
| InChIKey | OMQBFPNIZQDFBY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|